Organic acids and derivatives
Filtered Search Results
Ethylene glycol-O,O'-bis(2-aminoethyl)-N,N,N',N'-tetraacetic acid, 0.5M aq. soln., pH 8.0, autoclaved
CAS: 67-42-5 Molecular Formula: C14H24N2O10 Molecular Weight (g/mol): 380.35 MDL Number: MFCD00004291 InChI Key: DEFVIWRASFVYLL-UHFFFAOYSA-N Synonym: egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn PubChem CID: 6207 ChEBI: CHEBI:30740 IUPAC Name: 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid SMILES: C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O
| PubChem CID | 6207 |
|---|---|
| CAS | 67-42-5 |
| Molecular Weight (g/mol) | 380.35 |
| ChEBI | CHEBI:30740 |
| MDL Number | MFCD00004291 |
| SMILES | C(COCCOCCN(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| Synonym | egta,egtazic acid,gedta,ethylenebis oxyethylenenitrilo tetraacetic acid,ebonta,6,9-dioxa-3,12-diazatetradecanedioic acid, 3,12-bis carboxymethyl,1,2-bis 2-bis carboxymethyl amino ethoxy ethane,ethylene glycol tetraacetic acid,h4egta,egtazic acid usan:inn |
| IUPAC Name | 2-[2-[2-[2-[bis(carboxymethyl)amino]ethoxy]ethoxy]ethyl-(carboxymethyl)amino]acetic acid |
| InChI Key | DEFVIWRASFVYLL-UHFFFAOYSA-N |
| Molecular Formula | C14H24N2O10 |
tert-Butyl acetate, 99%
CAS: 540-88-5 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00008807 InChI Key: WMOVHXAZOJBABW-UHFFFAOYSA-N Synonym: t-butyl acetate,acetic acid tert-butyl ester,tert-butyl ethanoate,acetic acid, 1,1-dimethylethyl ester,texaco lead appreciator,acetic acid, tert-butyl ester,tert-butylacetate,tert butyl acetate,1,1-dimethylethyl acetate,1,1-dimethyl acetate PubChem CID: 10908 IUPAC Name: tert-butyl acetate SMILES: CC(=O)OC(C)(C)C
| PubChem CID | 10908 |
|---|---|
| CAS | 540-88-5 |
| Molecular Weight (g/mol) | 116.16 |
| MDL Number | MFCD00008807 |
| SMILES | CC(=O)OC(C)(C)C |
| Synonym | t-butyl acetate,acetic acid tert-butyl ester,tert-butyl ethanoate,acetic acid, 1,1-dimethylethyl ester,texaco lead appreciator,acetic acid, tert-butyl ester,tert-butylacetate,tert butyl acetate,1,1-dimethylethyl acetate,1,1-dimethyl acetate |
| IUPAC Name | tert-butyl acetate |
| InChI Key | WMOVHXAZOJBABW-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
5-Bromo-4-chloro-3-indolyl phosphate disodium salt, 98%
CAS: 102185-33-1 Molecular Formula: C8H4BrClNNa2O4P Molecular Weight (g/mol): 370.43 MDL Number: MFCD00036757 InChI Key: OAZUOCJOEUNDEK-UHFFFAOYSA-L PubChem CID: 6097197 IUPAC Name: disodium;(5-bromo-4-chloro-1H-indol-3-yl) phosphate SMILES: [Na+].[Na+].[O-]P([O-])(=O)OC1=CNC2=CC=C(Br)C(Cl)=C12
| PubChem CID | 6097197 |
|---|---|
| CAS | 102185-33-1 |
| Molecular Weight (g/mol) | 370.43 |
| MDL Number | MFCD00036757 |
| SMILES | [Na+].[Na+].[O-]P([O-])(=O)OC1=CNC2=CC=C(Br)C(Cl)=C12 |
| IUPAC Name | disodium;(5-bromo-4-chloro-1H-indol-3-yl) phosphate |
| InChI Key | OAZUOCJOEUNDEK-UHFFFAOYSA-L |
| Molecular Formula | C8H4BrClNNa2O4P |
Tri-o-tolyl phosphate, 96%
CAS: 78-30-8 Molecular Formula: C21H21O4P Molecular Weight (g/mol): 368.37 MDL Number: MFCD00041906 InChI Key: YSMRWXYRXBRSND-UHFFFAOYSA-N Synonym: tri-o-cresyl phosphate,tri-o-tolyl phosphate,o-tolyl phosphate,tocp,totp,phosphoric acid, tris 2-methylphenyl ester,o-cresyl phosphate,triorthocresyl phosphate,phosflex 179c,tri-2-tolyl phosphate PubChem CID: 6527 IUPAC Name: tris(2-methylphenyl) phosphate SMILES: CC1=CC=CC=C1OP(=O)(OC1=CC=CC=C1C)OC1=CC=CC=C1C
| PubChem CID | 6527 |
|---|---|
| CAS | 78-30-8 |
| Molecular Weight (g/mol) | 368.37 |
| MDL Number | MFCD00041906 |
| SMILES | CC1=CC=CC=C1OP(=O)(OC1=CC=CC=C1C)OC1=CC=CC=C1C |
| Synonym | tri-o-cresyl phosphate,tri-o-tolyl phosphate,o-tolyl phosphate,tocp,totp,phosphoric acid, tris 2-methylphenyl ester,o-cresyl phosphate,triorthocresyl phosphate,phosflex 179c,tri-2-tolyl phosphate |
| IUPAC Name | tris(2-methylphenyl) phosphate |
| InChI Key | YSMRWXYRXBRSND-UHFFFAOYSA-N |
| Molecular Formula | C21H21O4P |
Methyl Methacrylate (stabilized with 6-tert-Butyl-2,4-xylenol) 99.8+%, TCI America™
CAS: 80-62-6 Molecular Formula: C5H8O2 Molecular Weight (g/mol): 100.117 MDL Number: MFCD00008587 InChI Key: VVQNEPGJFQJSBK-UHFFFAOYSA-N Synonym: methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate PubChem CID: 6658 ChEBI: CHEBI:34840 IUPAC Name: methyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OC
| PubChem CID | 6658 |
|---|---|
| CAS | 80-62-6 |
| Molecular Weight (g/mol) | 100.117 |
| ChEBI | CHEBI:34840 |
| MDL Number | MFCD00008587 |
| SMILES | CC(=C)C(=O)OC |
| Synonym | methyl methacrylate,methylmethacrylate,methacrylic acid methyl ester,methyl methylacrylate,methyl 2-methylpropenoate,pegalan,methyl-methacrylat,diakon,acryester m,methyl 2-methyl-2-propenoate |
| IUPAC Name | methyl 2-methylprop-2-enoate |
| InChI Key | VVQNEPGJFQJSBK-UHFFFAOYSA-N |
| Molecular Formula | C5H8O2 |
Diphenylborinic acid 2-aminoethyl ester, 98%
CAS: 524-95-8 Molecular Formula: C14H16BNO Molecular Weight (g/mol): 225.10 MDL Number: MFCD00014823 InChI Key: BLZVCIGGICSWIG-UHFFFAOYSA-N Synonym: 2-aminoethyl diphenylborinate,2-apb,2-aminoethoxy diphenylborane,2-aminoethoxydiphenylborane,2-aminoethoxydiphenylborate,2-aminoethoxydiphenyl borate,o-2-aminoethyl diphenylborinic acid,b-2-aminoethoxy diphenylborane,2-diphenylboryl oxy ethanamine,borinic acid, o-2-aminoethyl diphenyl PubChem CID: 1598 SMILES: NCCOB(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 1598 |
|---|---|
| CAS | 524-95-8 |
| Molecular Weight (g/mol) | 225.10 |
| MDL Number | MFCD00014823 |
| SMILES | NCCOB(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 2-aminoethyl diphenylborinate,2-apb,2-aminoethoxy diphenylborane,2-aminoethoxydiphenylborane,2-aminoethoxydiphenylborate,2-aminoethoxydiphenyl borate,o-2-aminoethyl diphenylborinic acid,b-2-aminoethoxy diphenylborane,2-diphenylboryl oxy ethanamine,borinic acid, o-2-aminoethyl diphenyl |
| InChI Key | BLZVCIGGICSWIG-UHFFFAOYSA-N |
| Molecular Formula | C14H16BNO |
4-Vinyl-1,3-dioxolan-2-one, 99%
CAS: 4427-96-7 Molecular Formula: C5H6O3 Molecular Weight (g/mol): 114.1 MDL Number: MFCD00143315 InChI Key: BJWMSGRKJIOCNR-UHFFFAOYSA-N Synonym: 4-vinyl-1,3-dioxolan-2-one,vinylethylene carbonate,4-vinyl-1,3-dioxolan-2-one, stabilized with hydroquinone,1,3-dioxolan-2-one, 4-ethenyl,acmc-1ajgp,vec;,ksc383e5n,2-oxo-4-vinyl-1,3-dioxolane,4-vinyl-1,3 dioxolan-2-one,4-vinyl-1,3-dioxaolane-2-one PubChem CID: 2735038 IUPAC Name: 4-ethenyl-1,3-dioxolan-2-one SMILES: C=CC1COC(=O)O1
| PubChem CID | 2735038 |
|---|---|
| CAS | 4427-96-7 |
| Molecular Weight (g/mol) | 114.1 |
| MDL Number | MFCD00143315 |
| SMILES | C=CC1COC(=O)O1 |
| Synonym | 4-vinyl-1,3-dioxolan-2-one,vinylethylene carbonate,4-vinyl-1,3-dioxolan-2-one, stabilized with hydroquinone,1,3-dioxolan-2-one, 4-ethenyl,acmc-1ajgp,vec;,ksc383e5n,2-oxo-4-vinyl-1,3-dioxolane,4-vinyl-1,3 dioxolan-2-one,4-vinyl-1,3-dioxaolane-2-one |
| IUPAC Name | 4-ethenyl-1,3-dioxolan-2-one |
| InChI Key | BJWMSGRKJIOCNR-UHFFFAOYSA-N |
| Molecular Formula | C5H6O3 |
tert-Butyl acrylate, 99%, stabilized
CAS: 1663-39-4 Molecular Formula: C7H12O2 Molecular Weight (g/mol): 128.17 MDL Number: MFCD00008809 InChI Key: ISXSCDLOGDJUNJ-UHFFFAOYSA-N Synonym: tert-butyl acrylate,t-butyl acrylate,tert-butyl propenoate,2-propenoic acid, 1,1-dimethylethyl ester,acrylic acid tert-butyl ester,tert-butylacrylate,acrylic acid, tert-butyl ester,unii-92m2cd1o3g,ccris 7035,2-propenoic acid tert-butyl ester PubChem CID: 15458 IUPAC Name: tert-butyl prop-2-enoate SMILES: CC(C)(C)OC(=O)C=C
| PubChem CID | 15458 |
|---|---|
| CAS | 1663-39-4 |
| Molecular Weight (g/mol) | 128.17 |
| MDL Number | MFCD00008809 |
| SMILES | CC(C)(C)OC(=O)C=C |
| Synonym | tert-butyl acrylate,t-butyl acrylate,tert-butyl propenoate,2-propenoic acid, 1,1-dimethylethyl ester,acrylic acid tert-butyl ester,tert-butylacrylate,acrylic acid, tert-butyl ester,unii-92m2cd1o3g,ccris 7035,2-propenoic acid tert-butyl ester |
| IUPAC Name | tert-butyl prop-2-enoate |
| InChI Key | ISXSCDLOGDJUNJ-UHFFFAOYSA-N |
| Molecular Formula | C7H12O2 |
Diethyl vinylphosphonate, 97%
CAS: 682-30-4 Molecular Formula: C6H13O3P Molecular Weight (g/mol): 164.14 MDL Number: MFCD00009079 InChI Key: DREPONDJUKIQLX-UHFFFAOYSA-N Synonym: diethyl vinylphosphonate,vinylphosphonic acid diethyl ester,diethyl vinylphosphate,diethoxyphosphinylethene,phosphonic acid, vinyl-, diethyl ester,diethyl ethenylphosphonate,phosphonic acid, ethenyl-, diethyl ester,1-ethenyl ethoxy phosphoryl oxyethane,acmc-1at5g PubChem CID: 69629 IUPAC Name: 1-[ethenyl(ethoxy)phosphoryl]oxyethane SMILES: CCOP(=O)(OCC)C=C
| PubChem CID | 69629 |
|---|---|
| CAS | 682-30-4 |
| Molecular Weight (g/mol) | 164.14 |
| MDL Number | MFCD00009079 |
| SMILES | CCOP(=O)(OCC)C=C |
| Synonym | diethyl vinylphosphonate,vinylphosphonic acid diethyl ester,diethyl vinylphosphate,diethoxyphosphinylethene,phosphonic acid, vinyl-, diethyl ester,diethyl ethenylphosphonate,phosphonic acid, ethenyl-, diethyl ester,1-ethenyl ethoxy phosphoryl oxyethane,acmc-1at5g |
| IUPAC Name | 1-[ethenyl(ethoxy)phosphoryl]oxyethane |
| InChI Key | DREPONDJUKIQLX-UHFFFAOYSA-N |
| Molecular Formula | C6H13O3P |
trans-Aconitic acid, 98%
CAS: 4023-65-8 Molecular Formula: C6H6O6 Molecular Weight (g/mol): 174.108 MDL Number: MFCD00002721 InChI Key: GTZCVFVGUGFEME-HNQUOIGGSA-N Synonym: trans-aconitic acid,trans-aconitate,e-1-propene-1,2,3-tricarboxylic acid,aconitic acid,e-prop-1-ene-1,2,3-tricarboxylic acid,aconitic acid, trans,trans aconitic acid,e-aconitic acid,unii-7db37960cw,1e-1-propene-1,2,3-tricarboxylic acid PubChem CID: 444212 ChEBI: CHEBI:32806 IUPAC Name: (E)-prop-1-ene-1,2,3-tricarboxylic acid SMILES: C(C(=CC(=O)O)C(=O)O)C(=O)O
| PubChem CID | 444212 |
|---|---|
| CAS | 4023-65-8 |
| Molecular Weight (g/mol) | 174.108 |
| ChEBI | CHEBI:32806 |
| MDL Number | MFCD00002721 |
| SMILES | C(C(=CC(=O)O)C(=O)O)C(=O)O |
| Synonym | trans-aconitic acid,trans-aconitate,e-1-propene-1,2,3-tricarboxylic acid,aconitic acid,e-prop-1-ene-1,2,3-tricarboxylic acid,aconitic acid, trans,trans aconitic acid,e-aconitic acid,unii-7db37960cw,1e-1-propene-1,2,3-tricarboxylic acid |
| IUPAC Name | (E)-prop-1-ene-1,2,3-tricarboxylic acid |
| InChI Key | GTZCVFVGUGFEME-HNQUOIGGSA-N |
| Molecular Formula | C6H6O6 |
Sodium 1-butanesulfonate, 99%
CAS: 2386-54-1 Molecular Formula: C4H9NaO3S Molecular Weight (g/mol): 160.16 MDL Number: MFCD00007540 InChI Key: XQCHMGAOAWZUPI-UHFFFAOYSA-M Synonym: sodium 1-butanesulfonate,sodium butane-1-sulfonate,1-butanesulfonic acid sodium salt,sodium butylsulfonate,1-butanesulfonic acid, sodium salt,sodium butane-1-sulphonate,sodium butanesulfonate,ipc-alks-4,1-butanesulfonic acid, sodium salt 1:1,acmc-1cdot PubChem CID: 4096517 IUPAC Name: sodium;butane-1-sulfonate SMILES: [Na+].CCCCS([O-])(=O)=O
| PubChem CID | 4096517 |
|---|---|
| CAS | 2386-54-1 |
| Molecular Weight (g/mol) | 160.16 |
| MDL Number | MFCD00007540 |
| SMILES | [Na+].CCCCS([O-])(=O)=O |
| Synonym | sodium 1-butanesulfonate,sodium butane-1-sulfonate,1-butanesulfonic acid sodium salt,sodium butylsulfonate,1-butanesulfonic acid, sodium salt,sodium butane-1-sulphonate,sodium butanesulfonate,ipc-alks-4,1-butanesulfonic acid, sodium salt 1:1,acmc-1cdot |
| IUPAC Name | sodium;butane-1-sulfonate |
| InChI Key | XQCHMGAOAWZUPI-UHFFFAOYSA-M |
| Molecular Formula | C4H9NaO3S |
Potassium trifluoromethanesulfonate, 98%
CAS: 2926-27-4 Molecular Formula: CF3KO3S Molecular Weight (g/mol): 188.162 MDL Number: MFCD00042370 InChI Key: GLGXXYFYZWQGEL-UHFFFAOYSA-M Synonym: potassium trifluoromethanesulfonate,potassium triflate,trifluoromethanesulfonic acid potassium salt,potassium trifluoromethanesulphonate,methanesulfonic acid, trifluoro-, potassium salt,potassium ion triflate,cf3so3k,acmc-209h7u,potassium trifluoromethanesulfonate salt,potassium tris fluoranyl methanesulfonate PubChem CID: 23664779 IUPAC Name: potassium;trifluoromethanesulfonate SMILES: C(F)(F)(F)S(=O)(=O)[O-].[K+]
| PubChem CID | 23664779 |
|---|---|
| CAS | 2926-27-4 |
| Molecular Weight (g/mol) | 188.162 |
| MDL Number | MFCD00042370 |
| SMILES | C(F)(F)(F)S(=O)(=O)[O-].[K+] |
| Synonym | potassium trifluoromethanesulfonate,potassium triflate,trifluoromethanesulfonic acid potassium salt,potassium trifluoromethanesulphonate,methanesulfonic acid, trifluoro-, potassium salt,potassium ion triflate,cf3so3k,acmc-209h7u,potassium trifluoromethanesulfonate salt,potassium tris fluoranyl methanesulfonate |
| IUPAC Name | potassium;trifluoromethanesulfonate |
| InChI Key | GLGXXYFYZWQGEL-UHFFFAOYSA-M |
| Molecular Formula | CF3KO3S |
n-Propyl propionate, 99%
CAS: 106-36-5 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00009373 InChI Key: MCSINKKTEDDPNK-UHFFFAOYSA-N Synonym: propyl propionate,n-propyl propionate,propanoic acid, propyl ester,n-propyl propanoate,propionic acid, propyl ester,n-propyl n-propionate,propylester kyseliny propionove,unii-g09trv00gk,propyl propionate natural,propionic acid n-propyl ester PubChem CID: 7803 IUPAC Name: propyl propanoate SMILES: CCCOC(=O)CC
| PubChem CID | 7803 |
|---|---|
| CAS | 106-36-5 |
| Molecular Weight (g/mol) | 116.16 |
| MDL Number | MFCD00009373 |
| SMILES | CCCOC(=O)CC |
| Synonym | propyl propionate,n-propyl propionate,propanoic acid, propyl ester,n-propyl propanoate,propionic acid, propyl ester,n-propyl n-propionate,propylester kyseliny propionove,unii-g09trv00gk,propyl propionate natural,propionic acid n-propyl ester |
| IUPAC Name | propyl propanoate |
| InChI Key | MCSINKKTEDDPNK-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Dimethyl Oxalate 99.0+%, TCI America™
CAS: 553-90-2 Molecular Formula: C4H6O4 Molecular Weight (g/mol): 118.09 MDL Number: MFCD00008442 InChI Key: LOMVENUNSWAXEN-UHFFFAOYSA-N Synonym: methyl oxalate,ethanedioic acid, dimethyl ester,oxalic acid dimethyl ester,dimethyloxalate,oxalic acid, dimethyl ester,dimethyl ethanedioate,unii-iq3q79344s,ethanedioic acid, 1,2-dimethyl ester,dimethyl ethane-1,2-dioate,dimethyl ester of oxalic acid PubChem CID: 11120 ChEBI: CHEBI:6859 IUPAC Name: dimethyl oxalate SMILES: COC(=O)C(=O)OC
| PubChem CID | 11120 |
|---|---|
| CAS | 553-90-2 |
| Molecular Weight (g/mol) | 118.09 |
| ChEBI | CHEBI:6859 |
| MDL Number | MFCD00008442 |
| SMILES | COC(=O)C(=O)OC |
| Synonym | methyl oxalate,ethanedioic acid, dimethyl ester,oxalic acid dimethyl ester,dimethyloxalate,oxalic acid, dimethyl ester,dimethyl ethanedioate,unii-iq3q79344s,ethanedioic acid, 1,2-dimethyl ester,dimethyl ethane-1,2-dioate,dimethyl ester of oxalic acid |
| IUPAC Name | dimethyl oxalate |
| InChI Key | LOMVENUNSWAXEN-UHFFFAOYSA-N |
| Molecular Formula | C4H6O4 |
Sulfanilic acid, ACS, 98.0-102.0%
CAS: 121-57-3 Molecular Formula: C6H7NO3S Molecular Weight (g/mol): 173.186 MDL Number: MFCD00007886 InChI Key: HVBSAKJJOYLTQU-UHFFFAOYSA-N Synonym: sulfanilic acid,sulphanilic acid,p-aminobenzenesulfonic acid,sulfanilsaeure,aniline-4-sulfonic acid,benzenesulfonic acid, 4-amino,aniline-p-sulfonic acid,aniline-p-sulphonic acid,p-aminophenylsulfonic acid,sulfanilicacid PubChem CID: 8479 ChEBI: CHEBI:27500 IUPAC Name: 4-aminobenzenesulfonic acid SMILES: C1=CC(=CC=C1N)S(=O)(=O)O
| PubChem CID | 8479 |
|---|---|
| CAS | 121-57-3 |
| Molecular Weight (g/mol) | 173.186 |
| ChEBI | CHEBI:27500 |
| MDL Number | MFCD00007886 |
| SMILES | C1=CC(=CC=C1N)S(=O)(=O)O |
| Synonym | sulfanilic acid,sulphanilic acid,p-aminobenzenesulfonic acid,sulfanilsaeure,aniline-4-sulfonic acid,benzenesulfonic acid, 4-amino,aniline-p-sulfonic acid,aniline-p-sulphonic acid,p-aminophenylsulfonic acid,sulfanilicacid |
| IUPAC Name | 4-aminobenzenesulfonic acid |
| InChI Key | HVBSAKJJOYLTQU-UHFFFAOYSA-N |
| Molecular Formula | C6H7NO3S |